C17H22F2N2O3 — CID 146143091
4-[[[4-(difluoromethyl)phenyl]methylcarbamoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 146143091) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is 4-[[[4-(difluoromethyl)phenyl]methylcarbamoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[4-(difluoromethyl)phenyl]methylcarbamoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 146143091 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[[[4-(difluoromethyl)phenyl]methylcarbamoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCc1ccc(C(F)F)cc1)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H22F2N2O3/c18-15(19)13-5-1-11(2-6-13)9-20-17(24)21-10-12-3-7-14(8-4-12)16(22)23/h1-2,5-6,12,14-15H,3-4,7-10H2,(H,22,23)(H2,20,21,24) |
| InChIKey | PYTRYGJRXBVTFI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |