C15H19F2NO2 — CID 115529683
2-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 115529683) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 115529683 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1CNCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C15H19F2NO2/c16-14(17)11-4-1-3-10(7-11)8-18-9-12-5-2-6-13(12)15(19)20/h1,3-4,7,12-14,18H,2,5-6,8-9H2,(H,19,20) |
| InChIKey | JDAVYYPVPFSWBD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |