C15H17FN2O2 — CID 107118828
2-[[(3-cyano-2-fluorophenyl)methylamino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 107118828) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[[(3-cyano-2-fluorophenyl)methylamino]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[[(3-cyano-2-fluorophenyl)methylamino]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 107118828 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[[(3-cyano-2-fluorophenyl)methylamino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | N#Cc1cccc(CNCC2CCCC2C(=O)O)c1F |
| InChI | InChI=1S/C15H17FN2O2/c16-14-10(7-17)3-1-5-12(14)9-18-8-11-4-2-6-13(11)15(19)20/h1,3,5,11,13,18H,2,4,6,8-9H2,(H,19,20) |
| InChIKey | FOCXJUVWRGSVSU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |