C21H25NO3 — CID 113242302
2-[[(4-phenylmethoxyphenyl)methylamino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 113242302) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[[(4-phenylmethoxyphenyl)methylamino]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[[(4-phenylmethoxyphenyl)methylamino]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 113242302 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-[[(4-phenylmethoxyphenyl)methylamino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1CNCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO3/c23-21(24)20-8-4-7-18(20)14-22-13-16-9-11-19(12-10-16)25-15-17-5-2-1-3-6-17/h1-3,5-6,9-12,18,20,22H,4,7-8,13-15H2,(H,23,24) |
| InChIKey | GKNPZUWRVGVCGH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |