C16H22FNO2S — CID 79529800
4-[[2-(4-fluorophenyl)sulfanylethylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 79529800) has the molecular formula C16H22FNO2S and a molecular weight of 311.42 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)sulfanylethylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(4-fluorophenyl)sulfanylethylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79529800 |
| Molecular Formula | C16H22FNO2S |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)sulfanylethylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNCCSc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H22FNO2S/c17-14-5-7-15(8-6-14)21-10-9-18-11-12-1-3-13(4-2-12)16(19)20/h5-8,12-13,18H,1-4,9-11H2,(H,19,20) |
| InChIKey | QVRPRIIGXCQBHE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|