C16H22FNO2S — CID 106123655
3-(4-fluorophenyl)sulfanyl-N-[(4-hydroxycyclohexyl)methyl]propanamide (PubChem CID 106123655) has the molecular formula C16H22FNO2S and a molecular weight of 311.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N-[(4-hydroxycyclohexyl)methyl]propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N-[(4-hydroxycyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 106123655 |
| Molecular Formula | C16H22FNO2S |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N-[(4-hydroxycyclohexyl)methyl]propanamide |
| SMILES | O=C(CCSc1ccc(F)cc1)NCC1CCC(O)CC1 |
| InChI | InChI=1S/C16H22FNO2S/c17-13-3-7-15(8-4-13)21-10-9-16(20)18-11-12-1-5-14(19)6-2-12/h3-4,7-8,12,14,19H,1-2,5-6,9-11H2,(H,18,20) |
| InChIKey | YVBIGFGHNQLXPJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |