C11H16ClFN2OS — CID 119384723
N-(2-aminoethyl)-3-(4-fluorophenyl)sulfanylpropanamide;hydrochloride (PubChem CID 119384723) has the molecular formula C11H16ClFN2OS and a molecular weight of 278.78 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(4-fluorophenyl)sulfanylpropanamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-3-(4-fluorophenyl)sulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119384723 |
| Molecular Formula | C11H16ClFN2OS |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-(2-aminoethyl)-3-(4-fluorophenyl)sulfanylpropanamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2OS.ClH/c12-9-1-3-10(4-2-9)16-8-5-11(15)14-7-6-13;/h1-4H,5-8,13H2,(H,14,15);1H |
| InChIKey | ZMBOQKQGDSWLCY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |