C19H20FNO4S — CID 119255389
2-[4-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]ethyl]phenoxy]acetic acid (PubChem CID 119255389) has the molecular formula C19H20FNO4S and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[4-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119255389 |
| Molecular Formula | C19H20FNO4S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[4-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]ethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CCNC(=O)CCSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H20FNO4S/c20-15-3-7-17(8-4-15)26-12-10-18(22)21-11-9-14-1-5-16(6-2-14)25-13-19(23)24/h1-8H,9-13H2,(H,21,22)(H,23,24) |
| InChIKey | JGDMRNHVTAPSDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |