C16H16FNO5S2 — CID 10249487
2-[4-[2-[(4-fluorophenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid (PubChem CID 10249487) has the molecular formula C16H16FNO5S2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[4-[2-[(4-fluorophenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(4-fluorophenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10249487 |
| Molecular Formula | C16H16FNO5S2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-[4-[2-[(4-fluorophenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(SCCNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H16FNO5S2/c17-12-1-7-15(8-2-12)25(21,22)18-9-10-24-14-5-3-13(4-6-14)23-11-16(19)20/h1-8,18H,9-11H2,(H,19,20) |
| InChIKey | XQBFHXLYVDJWQL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|