C13H15NO5S — CID 106220067
2-[4-(pent-4-ynylsulfamoyl)phenoxy]acetic acid (PubChem CID 106220067) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[4-(pent-4-ynylsulfamoyl)phenoxy]acetic acid.
| Compound Name | 2-[4-(pent-4-ynylsulfamoyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 106220067 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[4-(pent-4-ynylsulfamoyl)phenoxy]acetic acid |
| SMILES | C#CCCCNS(=O)(=O)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO5S/c1-2-3-4-9-14-20(17,18)12-7-5-11(6-8-12)19-10-13(15)16/h1,5-8,14H,3-4,9-10H2,(H,15,16) |
| InChIKey | YLDYDFMNUXISAK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|