C17H18FNO5S2 — CID 10318745
2-[2-fluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid (PubChem CID 10318745) has the molecular formula C17H18FNO5S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[2-fluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[2-fluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10318745 |
| Molecular Formula | C17H18FNO5S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-[2-fluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCCSc2ccc(OCC(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C17H18FNO5S2/c1-12-2-5-14(6-3-12)26(22,23)19-8-9-25-13-4-7-16(15(18)10-13)24-11-17(20)21/h2-7,10,19H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | SWWMTVKUUTZEMU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|