C16H15ClF2N2O5S2 — CID 10389184
2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]-N-hydroxyacetamide (PubChem CID 10389184) has the molecular formula C16H15ClF2N2O5S2 and a molecular weight of 452.89 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]-N-hydroxyacetamide.
| Compound Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 10389184 |
| Molecular Formula | C16H15ClF2N2O5S2 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfanyl]-2,6-difluorophenoxy]-N-hydroxyacetamide |
| SMILES | O=C(COc1c(F)cc(SCCNS(=O)(=O)c2ccc(Cl)cc2)cc1F)NO |
| InChI | InChI=1S/C16H15ClF2N2O5S2/c17-10-1-3-12(4-2-10)28(24,25)20-5-6-27-11-7-13(18)16(14(19)8-11)26-9-15(22)21-23/h1-4,7-8,20,23H,5-6,9H2,(H,21,22) |
| InChIKey | ZGXZHDIFEBHAON-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|