C17H17F2NO5S2 — CID 151450795
[4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]methyl acetate (PubChem CID 151450795) has the molecular formula C17H17F2NO5S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is [4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]methyl acetate.
| Compound Name | [4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]methyl acetate |
|---|---|
| PubChem CID | 151450795 |
| Molecular Formula | C17H17F2NO5S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | [4-[2-(benzenesulfonamido)ethylsulfanyl]-2,6-difluorophenoxy]methyl acetate |
| SMILES | CC(=O)OCOc1c(F)cc(SCCNS(=O)(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C17H17F2NO5S2/c1-12(21)24-11-25-17-15(18)9-13(10-16(17)19)26-8-7-20-27(22,23)14-5-3-2-4-6-14/h2-6,9-10,20H,7-8,11H2,1H3 |
| InChIKey | PGLHZWKSOORZCR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|