C16H15F2NO5S2 — CID 57203623
2-[4-[2-(benzenesulfonamido)-1-sulfanylethyl]-2,6-difluorophenoxy]acetic acid (PubChem CID 57203623) has the molecular formula C16H15F2NO5S2 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-[4-[2-(benzenesulfonamido)-1-sulfanylethyl]-2,6-difluorophenoxy]acetic acid.
| Compound Name | 2-[4-[2-(benzenesulfonamido)-1-sulfanylethyl]-2,6-difluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 57203623 |
| Molecular Formula | C16H15F2NO5S2 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 2-[4-[2-(benzenesulfonamido)-1-sulfanylethyl]-2,6-difluorophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(F)cc(C(S)CNS(=O)(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C16H15F2NO5S2/c17-12-6-10(7-13(18)16(12)24-9-15(20)21)14(25)8-19-26(22,23)11-4-2-1-3-5-11/h1-7,14,19,25H,8-9H2,(H,20,21) |
| InChIKey | LXNUAOJNJBCBFO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|