C10H12N2O6S — CID 63914257
2-[[2-(benzenesulfonamido)acetyl]amino]oxyacetic acid (PubChem CID 63914257) has the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-[[2-(benzenesulfonamido)acetyl]amino]oxyacetic acid.
| Compound Name | 2-[[2-(benzenesulfonamido)acetyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 63914257 |
| Molecular Formula | C10H12N2O6S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[[2-(benzenesulfonamido)acetyl]amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O6S/c13-9(12-18-7-10(14)15)6-11-19(16,17)8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,12,13)(H,14,15) |
| InChIKey | NAHHBKVHWBZPKU-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|