C12H18N2O5S — CID 62499250
2-(benzenesulfonamido)-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 62499250) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 62499250 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)NCCOCCO |
| InChI | InChI=1S/C12H18N2O5S/c15-7-9-19-8-6-13-12(16)10-14-20(17,18)11-4-2-1-3-5-11/h1-5,14-15H,6-10H2,(H,13,16) |
| InChIKey | ZSNYJCSZINEHNB-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|