C12H17F3N4O5S2 — CID 166213486
2-(benzenesulfonamido)-N-[2-(2,2,2-trifluoroethylsulfamoylamino)ethyl]acetamide (PubChem CID 166213486) has the molecular formula C12H17F3N4O5S2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-(2,2,2-trifluoroethylsulfamoylamino)ethyl]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[2-(2,2,2-trifluoroethylsulfamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 166213486 |
| Molecular Formula | C12H17F3N4O5S2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-(2,2,2-trifluoroethylsulfamoylamino)ethyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)NCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H17F3N4O5S2/c13-12(14,15)9-19-26(23,24)17-7-6-16-11(20)8-18-25(21,22)10-4-2-1-3-5-10/h1-5,17-19H,6-9H2,(H,16,20) |
| InChIKey | JMJRQUKMBLCKRH-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|