C14H12F3NO2S — CID 3734615
4-phenyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 3734615) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is 4-phenyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-phenyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3734615 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-phenyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12F3NO2S/c15-14(16,17)10-18-21(19,20)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,18H,10H2 |
| InChIKey | HXYPHABOIVKTRB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |