C8H7ClF3NO4S2 — CID 43096777
4-(2,2,2-trifluoroethylsulfamoyl)benzenesulfonyl chloride (PubChem CID 43096777) has the molecular formula C8H7ClF3NO4S2 and a molecular weight of 337.73 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 4-(2,2,2-trifluoroethylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43096777 |
| Molecular Formula | C8H7ClF3NO4S2 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 4-(2,2,2-trifluoroethylsulfamoyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7ClF3NO4S2/c9-18(14,15)6-1-3-7(4-2-6)19(16,17)13-5-8(10,11)12/h1-4,13H,5H2 |
| InChIKey | LEPFENCWGMWGBO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |