C8H10F3N3O2S — CID 43454892
4-hydrazinyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 43454892) has the molecular formula C8H10F3N3O2S and a molecular weight of 269.25 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43454892 |
| Molecular Formula | C8H10F3N3O2S |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-hydrazinyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H10F3N3O2S/c9-8(10,11)5-13-17(15,16)7-3-1-6(14-12)2-4-7/h1-4,13-14H,5,12H2 |
| InChIKey | PXZJSOANNLUKCW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|