C20H15F4NO2S — CID 3778780
N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-phenylbenzenesulfonamide (PubChem CID 3778780) has the molecular formula C20H15F4NO2S and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 3778780 |
| Molecular Formula | C20H15F4NO2S |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(C(F)(F)F)ccc1F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15F4NO2S/c21-19-11-8-17(20(22,23)24)12-16(19)13-25-28(26,27)18-9-6-15(7-10-18)14-4-2-1-3-5-14/h1-12,25H,13H2 |
| InChIKey | PFHVWKMFPSJGPK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |