C15H10F7NO2S — CID 3781688
N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 3781688) has the molecular formula C15H10F7NO2S and a molecular weight of 401.30 g/mol. Its IUPAC name is N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3781688 |
| Molecular Formula | C15H10F7NO2S |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(C(F)(F)F)ccc1F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F7NO2S/c16-13-5-4-11(15(20,21)22)6-9(13)8-23-26(24,25)12-3-1-2-10(7-12)14(17,18)19/h1-7,23H,8H2 |
| InChIKey | AUDFELPPWYOWNX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |