C13H10BrF3N2O2S — CID 145433996
N-[(6-bromo-2-pyridinyl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 145433996) has the molecular formula C13H10BrF3N2O2S and a molecular weight of 395.20 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 145433996 |
| Molecular Formula | C13H10BrF3N2O2S |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cccc(Br)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10BrF3N2O2S/c14-12-6-2-4-10(19-12)8-18-22(20,21)11-5-1-3-9(7-11)13(15,16)17/h1-7,18H,8H2 |
| InChIKey | ZPQFBSNXFZBTIK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|