C17H19F3N4O2S — CID 91967327
N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 91967327) has the molecular formula C17H19F3N4O2S and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91967327 |
| Molecular Formula | C17H19F3N4O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(N2CCCCC2)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3N4O2S/c18-17(19,20)13-5-4-6-15(11-13)27(25,26)22-12-14-7-8-21-16(23-14)24-9-2-1-3-10-24/h4-8,11,22H,1-3,9-10,12H2 |
| InChIKey | OKZGVRYFFAOXLJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |