C14H23N5O2S — CID 122353302
N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]pyrrolidine-1-sulfonamide (PubChem CID 122353302) has the molecular formula C14H23N5O2S and a molecular weight of 325.44 g/mol. Its IUPAC name is N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 122353302 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(N2CCCCC2)n1)N1CCCC1 |
| InChI | InChI=1S/C14H23N5O2S/c20-22(21,19-10-4-5-11-19)16-12-13-6-7-15-14(17-13)18-8-2-1-3-9-18/h6-7,16H,1-5,8-12H2 |
| InChIKey | FWEVGTSPAGEKOF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |