C16H22N4O2S2 — CID 122353235
5-ethyl-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 122353235) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-ethyl-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122353235 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-ethyl-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCc2ccnc(N3CCCCC3)n2)s1 |
| InChI | InChI=1S/C16H22N4O2S2/c1-2-14-6-7-15(23-14)24(21,22)18-12-13-8-9-17-16(19-13)20-10-4-3-5-11-20/h6-9,18H,2-5,10-12H2,1H3 |
| InChIKey | ZWBFVSBTTIDWGC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |