C14H13F3N2O2S — CID 75415095
N-[(3-aminophenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 75415095) has the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3-aminophenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 75415095 |
| Molecular Formula | C14H13F3N2O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Nc1cccc(CNS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C14H13F3N2O2S/c15-14(16,17)11-4-2-6-13(8-11)22(20,21)19-9-10-3-1-5-12(18)7-10/h1-8,19H,9,18H2 |
| InChIKey | LXJJUIYFURQUIR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|