C18H20F3NO4S — CID 47009155
3,4-diethoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 47009155) has the molecular formula C18H20F3NO4S and a molecular weight of 403.42 g/mol. Its IUPAC name is 3,4-diethoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47009155 |
| Molecular Formula | C18H20F3NO4S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3,4-diethoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2cccc(C(F)(F)F)c2)cc1OCC |
| InChI | InChI=1S/C18H20F3NO4S/c1-3-25-16-9-8-15(11-17(16)26-4-2)27(23,24)22-12-13-6-5-7-14(10-13)18(19,20)21/h5-11,22H,3-4,12H2,1-2H3 |
| InChIKey | ODYXRJOGEFDESO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |