C15H10F7NO3S — CID 3543365
N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3543365) has the molecular formula C15H10F7NO3S and a molecular weight of 417.30 g/mol. Its IUPAC name is N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3543365 |
| Molecular Formula | C15H10F7NO3S |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(C(F)(F)F)cc1F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F7NO3S/c16-13-7-10(14(17,18)19)2-1-9(13)8-23-27(24,25)12-5-3-11(4-6-12)26-15(20,21)22/h1-7,23H,8H2 |
| InChIKey | WGHULDMECONSMU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |