C15H14F3NO3S2 — CID 3801514
N-[(4-methylsulfanylphenyl)methyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3801514) has the molecular formula C15H14F3NO3S2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(4-methylsulfanylphenyl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3801514 |
| Molecular Formula | C15H14F3NO3S2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CSc1ccc(CNS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H14F3NO3S2/c1-23-13-6-2-11(3-7-13)10-19-24(20,21)14-8-4-12(5-9-14)22-15(16,17)18/h2-9,19H,10H2,1H3 |
| InChIKey | VCLZZXUEGVIYCB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |