C18H24N2O2S2 — CID 99933129
N-[[4-(diethylamino)phenyl]methyl]-4-methylsulfanylbenzenesulfonamide (PubChem CID 99933129) has the molecular formula C18H24N2O2S2 and a molecular weight of 364.54 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-4-methylsulfanylbenzenesulfonamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-4-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 99933129 |
| Molecular Formula | C18H24N2O2S2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-4-methylsulfanylbenzenesulfonamide |
| SMILES | CCN(CC)c1ccc(CNS(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C18H24N2O2S2/c1-4-20(5-2)16-8-6-15(7-9-16)14-19-24(21,22)18-12-10-17(23-3)11-13-18/h6-13,19H,4-5,14H2,1-3H3 |
| InChIKey | YMYDHCRYICYUPI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|