C10H14KNO3S2 — CID 21204713
potassium 1-(diethylamino)-4-sulfonatosulfanylbenzene (PubChem CID 21204713) has the molecular formula C10H14KNO3S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is potassium 1-(diethylamino)-4-sulfonatosulfanylbenzene.
| Compound Name | potassium 1-(diethylamino)-4-sulfonatosulfanylbenzene |
|---|---|
| PubChem CID | 21204713 |
| Molecular Formula | C10H14KNO3S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | potassium 1-(diethylamino)-4-sulfonatosulfanylbenzene |
| SMILES | CCN(CC)c1ccc(SS(=O)(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C10H15NO3S2.K/c1-3-11(4-2)9-5-7-10(8-6-9)15-16(12,13)14;/h5-8H,3-4H2,1-2H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | YYFOQGNTMASGCP-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|