C26H32N2O4S2 — CID 6432220
N-[4-(diethylamino)phenyl]-N-(3,4-dimethylphenyl)sulfonyl-3,4-dimethylbenzenesulfonamide (PubChem CID 6432220) has the molecular formula C26H32N2O4S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-N-(3,4-dimethylphenyl)sulfonyl-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(diethylamino)phenyl]-N-(3,4-dimethylphenyl)sulfonyl-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 6432220 |
| Molecular Formula | C26H32N2O4S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-N-(3,4-dimethylphenyl)sulfonyl-3,4-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)c1ccc(N(S(=O)(=O)c2ccc(C)c(C)c2)S(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C26H32N2O4S2/c1-7-27(8-2)23-11-13-24(14-12-23)28(33(29,30)25-15-9-19(3)21(5)17-25)34(31,32)26-16-10-20(4)22(6)18-26/h9-18H,7-8H2,1-6H3 |
| InChIKey | KLTGOXURDPDGLK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|