C17H20O2S — CID 90181116
4-(4-ethyl-3-methylphenyl)sulfonyl-1,2-dimethylbenzene (PubChem CID 90181116) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 4-(4-ethyl-3-methylphenyl)sulfonyl-1,2-dimethylbenzene.
| Compound Name | 4-(4-ethyl-3-methylphenyl)sulfonyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 90181116 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-(4-ethyl-3-methylphenyl)sulfonyl-1,2-dimethylbenzene |
| SMILES | CCc1ccc(S(=O)(=O)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C17H20O2S/c1-5-15-7-9-17(11-14(15)4)20(18,19)16-8-6-12(2)13(3)10-16/h6-11H,5H2,1-4H3 |
| InChIKey | IACGCBFLXURLOE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |