C35H34F6O2S — CID 146371641
4-[2-[4-[2-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenyl]ethyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene (PubChem CID 146371641) has the molecular formula C35H34F6O2S and a molecular weight of 632.71 g/mol. Its IUPAC name is 4-[2-[4-[2-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenyl]ethyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-[4-[2-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenyl]ethyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 146371641 |
| Molecular Formula | C35H34F6O2S |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 4-[2-[4-[2-[4-(3,4-dimethylphenyl)sulfonyl-2-methylphenyl]ethyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(c2ccc(CCc3ccc(S(=O)(=O)c4ccc(C)c(C)c4)cc3C)c(C)c2)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C35H34F6O2S/c1-21-7-13-29(17-23(21)3)33(34(36,37)38,35(39,40)41)30-14-11-27(25(5)18-30)9-10-28-12-16-32(20-26(28)6)44(42,43)31-15-8-22(2)24(4)19-31/h7-8,11-20H,9-10H2,1-6H3 |
| InChIKey | OQUMIIZJEGSGRK-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |