C17H12F6I2 — CID 153123968
4-[2-(3,4-diiodophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene (PubChem CID 153123968) has the molecular formula C17H12F6I2 and a molecular weight of 584.08 g/mol. Its IUPAC name is 4-[2-(3,4-diiodophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-(3,4-diiodophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 153123968 |
| Molecular Formula | C17H12F6I2 |
| Molecular Weight | 584.08 g/mol |
| Exact Mass | 583.89 |
| IUPAC Name | 4-[2-(3,4-diiodophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(c2ccc(I)c(I)c2)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C17H12F6I2/c1-9-3-4-11(7-10(9)2)15(16(18,19)20,17(21,22)23)12-5-6-13(24)14(25)8-12/h3-8H,1-2H3 |
| InChIKey | VVKRQCSJNRMKLP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.08 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|