C19H18F7I — CID 157227337
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2-dimethylbenzene;4-iodo-1,2-dimethylbenzene (PubChem CID 157227337) has the molecular formula C19H18F7I and a molecular weight of 506.24 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2-dimethylbenzene;4-iodo-1,2-dimethylbenzene.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2-dimethylbenzene;4-iodo-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 157227337 |
| Molecular Formula | C19H18F7I |
| Molecular Weight | 506.24 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2-dimethylbenzene;4-iodo-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1C.Cc1ccc(I)cc1C |
| InChI | InChI=1S/C11H9F7.C8H9I/c1-6-3-4-8(5-7(6)2)9(12,10(13,14)15)11(16,17)18;1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3;3-5H,1-2H3 |
| InChIKey | ATRPEXPMNJPZCR-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.24 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|