C41H40F6 — CID 54517400
4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene;4-[4-(3,4-dimethylphenyl)phenyl]-1,2-dimethylbenzene (PubChem CID 54517400) has the molecular formula C41H40F6 and a molecular weight of 646.76 g/mol. Its IUPAC name is 4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene;4-[4-(3,4-dimethylphenyl)phenyl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene;4-[4-(3,4-dimethylphenyl)phenyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 54517400 |
| Molecular Formula | C41H40F6 |
| Molecular Weight | 646.76 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | 4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene;4-[4-(3,4-dimethylphenyl)phenyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C)c(C)c3)cc2)cc1C.Cc1ccc(C(c2ccc(C)c(C)c2)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C22H22.C19H18F6/c1-15-5-7-21(13-17(15)3)19-9-11-20(12-10-19)22-8-6-16(2)18(4)14-22;1-11-5-7-15(9-13(11)3)17(18(20,21)22,19(23,24)25)16-8-6-12(2)14(4)10-16/h5-14H,1-4H3;5-10H,1-4H3 |
| InChIKey | YNIXIKGVPGLWQS-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.76 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |