C18H16F6 — CID 58193383
4-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-1,2-dimethylbenzene (PubChem CID 58193383) has the molecular formula C18H16F6 and a molecular weight of 346.31 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-1,2-dimethylbenzene.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 58193383 |
| Molecular Formula | C18H16F6 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(3-methylphenyl)propan-2-yl]-1,2-dimethylbenzene |
| SMILES | Cc1cccc(C(c2ccc(C)c(C)c2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F6/c1-11-5-4-6-14(9-11)16(17(19,20)21,18(22,23)24)15-8-7-12(2)13(3)10-15/h4-10H,1-3H3 |
| InChIKey | VIRSSIBTLJZFEE-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |