C18H14F8 — CID 158300208
1-methyl-3-[1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropyl)phenyl]ethyl]benzene (PubChem CID 158300208) has the molecular formula C18H14F8 and a molecular weight of 382.29 g/mol. Its IUPAC name is 1-methyl-3-[1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropyl)phenyl]ethyl]benzene.
| Compound Name | 1-methyl-3-[1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 158300208 |
| Molecular Formula | C18H14F8 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-methyl-3-[1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropyl)phenyl]ethyl]benzene |
| SMILES | Cc1cccc(C(F)(F)C(F)(F)c2ccc(C(F)(F)C(C)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H14F8/c1-11-4-3-5-14(10-11)18(25,26)17(23,24)13-8-6-12(7-9-13)16(21,22)15(2,19)20/h3-10H,1-2H3 |
| InChIKey | GMKGKNAJAKZSSK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|