C16H10F8 — CID 101027772
1,2,4,5-tetrafluoro-3-methyl-6-[1,1,2,2-tetrafluoro-2-(3-methylphenyl)ethyl]benzene (PubChem CID 101027772) has the molecular formula C16H10F8 and a molecular weight of 354.24 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methyl-6-[1,1,2,2-tetrafluoro-2-(3-methylphenyl)ethyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methyl-6-[1,1,2,2-tetrafluoro-2-(3-methylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 101027772 |
| Molecular Formula | C16H10F8 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methyl-6-[1,1,2,2-tetrafluoro-2-(3-methylphenyl)ethyl]benzene |
| SMILES | Cc1cccc(C(F)(F)C(F)(F)c2c(F)c(F)c(C)c(F)c2F)c1 |
| InChI | InChI=1S/C16H10F8/c1-7-4-3-5-9(6-7)15(21,22)16(23,24)10-13(19)11(17)8(2)12(18)14(10)20/h3-6H,1-2H3 |
| InChIKey | QGCZPXNQCOBKGS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|