C18H18F4 — CID 139607359
1-[2-(3,5-dimethylphenyl)-1,1,2,2-tetrafluoroethyl]-3,5-dimethylbenzene (PubChem CID 139607359) has the molecular formula C18H18F4 and a molecular weight of 310.33 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)-1,1,2,2-tetrafluoroethyl]-3,5-dimethylbenzene.
| Compound Name | 1-[2-(3,5-dimethylphenyl)-1,1,2,2-tetrafluoroethyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 139607359 |
| Molecular Formula | C18H18F4 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)-1,1,2,2-tetrafluoroethyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(C(F)(F)C(F)(F)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C18H18F4/c1-11-5-12(2)8-15(7-11)17(19,20)18(21,22)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | AAGGDAFODYVKQZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|