C11H13BrF2O — CID 107140313
1-bromo-2-(3,5-dimethylphenyl)-1,1-difluoropropan-2-ol (PubChem CID 107140313) has the molecular formula C11H13BrF2O and a molecular weight of 279.12 g/mol. Its IUPAC name is 1-bromo-2-(3,5-dimethylphenyl)-1,1-difluoropropan-2-ol.
| Compound Name | 1-bromo-2-(3,5-dimethylphenyl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 107140313 |
| Molecular Formula | C11H13BrF2O |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 1-bromo-2-(3,5-dimethylphenyl)-1,1-difluoropropan-2-ol |
| SMILES | Cc1cc(C)cc(C(C)(O)C(F)(F)Br)c1 |
| InChI | InChI=1S/C11H13BrF2O/c1-7-4-8(2)6-9(5-7)10(3,15)11(12,13)14/h4-6,15H,1-3H3 |
| InChIKey | XHFAMEQWQPYKQB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|