C13H20O4 — CID 88693139
1,3-bis(2-hydroperoxypropan-2-yl)-5-methylbenzene (PubChem CID 88693139) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1,3-bis(2-hydroperoxypropan-2-yl)-5-methylbenzene.
| Compound Name | 1,3-bis(2-hydroperoxypropan-2-yl)-5-methylbenzene |
|---|---|
| PubChem CID | 88693139 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1,3-bis(2-hydroperoxypropan-2-yl)-5-methylbenzene |
| SMILES | Cc1cc(C(C)(C)OO)cc(C(C)(C)OO)c1 |
| InChI | InChI=1S/C13H20O4/c1-9-6-10(12(2,3)16-14)8-11(7-9)13(4,5)17-15/h6-8,14-15H,1-5H3 |
| InChIKey | AMGAEMKQECRQJX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|