C36H60O4 — CID 141239687
1-tert-butyl-3,5-bis(2-methoxypropan-2-yl)benzene (PubChem CID 141239687) has the molecular formula C36H60O4 and a molecular weight of 556.87 g/mol. Its IUPAC name is 1-tert-butyl-3,5-bis(2-methoxypropan-2-yl)benzene.
| Compound Name | 1-tert-butyl-3,5-bis(2-methoxypropan-2-yl)benzene |
|---|---|
| PubChem CID | 141239687 |
| Molecular Formula | C36H60O4 |
| Molecular Weight | 556.87 g/mol |
| Exact Mass | 556.45 |
| IUPAC Name | 1-tert-butyl-3,5-bis(2-methoxypropan-2-yl)benzene |
| SMILES | COC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)OC)c1.COC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)OC)c1 |
| InChI | InChI=1S/2C18H30O2/c2*1-16(2,3)13-10-14(17(4,5)19-8)12-15(11-13)18(6,7)20-9/h2*10-12H,1-9H3 |
| InChIKey | NGXJZLPJKNLSDH-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.87 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |