C14H23OP — CID 59664555
(3,5-ditert-butylphenoxy)phosphane (PubChem CID 59664555) has the molecular formula C14H23OP and a molecular weight of 238.31 g/mol. Its IUPAC name is (3,5-ditert-butylphenoxy)phosphane.
| Compound Name | (3,5-ditert-butylphenoxy)phosphane |
|---|---|
| PubChem CID | 59664555 |
| Molecular Formula | C14H23OP |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (3,5-ditert-butylphenoxy)phosphane |
| SMILES | CC(C)(C)c1cc(OP)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H23OP/c1-13(2,3)10-7-11(14(4,5)6)9-12(8-10)15-16/h7-9H,16H2,1-6H3 |
| InChIKey | AEUBIPQICBFCGU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|