C29H44O2 — CID 21044549
1,3-ditert-butyl-5-[(3,5-ditert-butylphenoxy)methoxy]benzene (PubChem CID 21044549) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[(3,5-ditert-butylphenoxy)methoxy]benzene.
| Compound Name | 1,3-ditert-butyl-5-[(3,5-ditert-butylphenoxy)methoxy]benzene |
|---|---|
| PubChem CID | 21044549 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 1,3-ditert-butyl-5-[(3,5-ditert-butylphenoxy)methoxy]benzene |
| SMILES | CC(C)(C)c1cc(OCOc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H44O2/c1-26(2,3)20-13-21(27(4,5)6)16-24(15-20)30-19-31-25-17-22(28(7,8)9)14-23(18-25)29(10,11)12/h13-18H,19H2,1-12H3 |
| InChIKey | OMTHTZDECBSKPD-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|