C23H32O2 — CID 86190346
1,3-ditert-butyl-5-[2-(4-methylphenoxy)ethoxy]benzene (PubChem CID 86190346) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[2-(4-methylphenoxy)ethoxy]benzene.
| Compound Name | 1,3-ditert-butyl-5-[2-(4-methylphenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 86190346 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1,3-ditert-butyl-5-[2-(4-methylphenoxy)ethoxy]benzene |
| SMILES | Cc1ccc(OCCOc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C23H32O2/c1-17-8-10-20(11-9-17)24-12-13-25-21-15-18(22(2,3)4)14-19(16-21)23(5,6)7/h8-11,14-16H,12-13H2,1-7H3 |
| InChIKey | YQUIFWIHPFKRLW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|