C16H16Cl2O2 — CID 58376578
1,3-dichloro-5-methyl-2-[2-(4-methylphenoxy)ethoxy]benzene (PubChem CID 58376578) has the molecular formula C16H16Cl2O2 and a molecular weight of 311.21 g/mol. Its IUPAC name is 1,3-dichloro-5-methyl-2-[2-(4-methylphenoxy)ethoxy]benzene.
| Compound Name | 1,3-dichloro-5-methyl-2-[2-(4-methylphenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 58376578 |
| Molecular Formula | C16H16Cl2O2 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 1,3-dichloro-5-methyl-2-[2-(4-methylphenoxy)ethoxy]benzene |
| SMILES | Cc1ccc(OCCOc2c(Cl)cc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2O2/c1-11-3-5-13(6-4-11)19-7-8-20-16-14(17)9-12(2)10-15(16)18/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | APENJUNQGWVAIC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|