C21H23Cl2NO4 — CID 69153693
4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxylic acid (PubChem CID 69153693) has the molecular formula C21H23Cl2NO4 and a molecular weight of 424.32 g/mol. Its IUPAC name is 4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxylic acid.
| Compound Name | 4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69153693 |
| Molecular Formula | C21H23Cl2NO4 |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxylic acid |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc(C3CCNCC3C(=O)O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H23Cl2NO4/c1-13-10-18(22)20(19(23)11-13)28-9-8-27-15-4-2-14(3-5-15)16-6-7-24-12-17(16)21(25)26/h2-5,10-11,16-17,24H,6-9,12H2,1H3,(H,25,26) |
| InChIKey | HCVBHVJFTGFQTK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|